C23H30N4O4 — CID 25103232
tert-butyl 4-[[5-(4-acetamidophenyl)pyrimidin-2-yl]oxymethyl]piperidine-1-carboxylate (PubChem CID 25103232) has the molecular formula C23H30N4O4 and a molecular weight of 426.52 g/mol. Its IUPAC name is tert-butyl 4-[[5-(4-acetamidophenyl)pyrimidin-2-yl]oxymethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[5-(4-acetamidophenyl)pyrimidin-2-yl]oxymethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 25103232 |
| Molecular Formula | C23H30N4O4 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | tert-butyl 4-[[5-(4-acetamidophenyl)pyrimidin-2-yl]oxymethyl]piperidine-1-carboxylate |
| SMILES | CC(=O)Nc1ccc(-c2cnc(OCC3CCN(C(=O)OC(C)(C)C)CC3)nc2)cc1 |
| InChI | InChI=1S/C23H30N4O4/c1-16(28)26-20-7-5-18(6-8-20)19-13-24-21(25-14-19)30-15-17-9-11-27(12-10-17)22(29)31-23(2,3)4/h5-8,13-14,17H,9-12,15H2,1-4H3,(H,26,28) |
| InChIKey | WLWHGUCDWRDLSR-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |