About N-(oxan-4-yl)-3-(2-phenoxyphenyl)imidazo[1,2-b]pyridazin-6-amine
N-(oxan-4-yl)-3-(2-phenoxyphenyl)imidazo[1,2-b]pyridazin-6-amine (PubChem CID 25104047) has the molecular formula C23H22N4O2
and a molecular weight of 386.46 g/mol. Its IUPAC name is N-(oxan-4-yl)-3-(2-phenoxyphenyl)imidazo[1,2-b]pyridazin-6-amine.
Molecular Properties
| Compound Name | N-(oxan-4-yl)-3-(2-phenoxyphenyl)imidazo[1,2-b]pyridazin-6-amine |
| PubChem CID | 25104047 |
| Molecular Formula | C23H22N4O2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | N-(oxan-4-yl)-3-(2-phenoxyphenyl)imidazo[1,2-b]pyridazin-6-amine |
| SMILES | c1ccc(Oc2ccccc2-c2cnc3ccc(NC4CCOCC4)nn23)cc1 |
| InChI | InChI=1S/C23H22N4O2/c1-2-6-18(7-3-1)29-21-9-5-4-8-19(21)20-16-24-23-11-10-22(26-27(20)23)25-17-12-14-28-15-13-17/h1-11,16-17H,12-15H2,(H,25,26) |
| InChIKey | RZNLIJIWSORCTH-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(oxan-4-yl)-3-(2-phenoxyphenyl)imidazo[1,2-b]pyridazin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(oxan-4-yl)-3-(2-phenoxyphenyl)imidazo[1,2-b]pyridazin-6-amine?
The IUPAC name of N-(oxan-4-yl)-3-(2-phenoxyphenyl)imidazo[1,2-b]pyridazin-6-amine (CID 25104047) is N-(oxan-4-yl)-3-(2-phenoxyphenyl)imidazo[1,2-b]pyridazin-6-amine.
What is the SMILES notation for N-(oxan-4-yl)-3-(2-phenoxyphenyl)imidazo[1,2-b]pyridazin-6-amine?
The canonical SMILES for N-(oxan-4-yl)-3-(2-phenoxyphenyl)imidazo[1,2-b]pyridazin-6-amine is c1ccc(Oc2ccccc2-c2cnc3ccc(NC4CCOCC4)nn23)cc1.
What is the InChIKey of N-(oxan-4-yl)-3-(2-phenoxyphenyl)imidazo[1,2-b]pyridazin-6-amine?
The InChIKey is RZNLIJIWSORCTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N4O2/c1-2-6-18(7-3-1)29-21-9-5-4-8-19(21)20-16-24-23-11-10-22(26-27(20)23)25-17-12-14-28-15-13-17/h1-11,16-17H,12-15H2,(H,25,26).
What are the key properties of N-(oxan-4-yl)-3-(2-phenoxyphenyl)imidazo[1,2-b]pyridazin-6-amine?
N-(oxan-4-yl)-3-(2-phenoxyphenyl)imidazo[1,2-b]pyridazin-6-amine has a molecular weight of 386.46 g/mol, XLogP of 4.78, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(oxan-4-yl)-3-(2-phenoxyphenyl)imidazo[1,2-b]pyridazin-6-amine is sourced from PubChem (CID 25104047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).