C20H24N6O — CID 166806973
3-[4-ethanimidoyl-3-(methylamino)phenyl]-N-(oxan-4-yl)imidazo[1,2-b]pyridazin-6-amine (PubChem CID 166806973) has the molecular formula C20H24N6O and a molecular weight of 364.45 g/mol. Its IUPAC name is 3-[4-ethanimidoyl-3-(methylamino)phenyl]-N-(oxan-4-yl)imidazo[1,2-b]pyridazin-6-amine.
| Compound Name | 3-[4-ethanimidoyl-3-(methylamino)phenyl]-N-(oxan-4-yl)imidazo[1,2-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 166806973 |
| Molecular Formula | C20H24N6O |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 3-[4-ethanimidoyl-3-(methylamino)phenyl]-N-(oxan-4-yl)imidazo[1,2-b]pyridazin-6-amine |
| SMILES | [H]/N=C(\C)c1ccc(-c2cnc3ccc(NC4CCOCC4)nn23)cc1NC |
| InChI | InChI=1S/C20H24N6O/c1-13(21)16-4-3-14(11-17(16)22-2)18-12-23-20-6-5-19(25-26(18)20)24-15-7-9-27-10-8-15/h3-6,11-12,15,21-22H,7-10H2,1-2H3,(H,24,25)/b21-13+ |
| InChIKey | QYXXTSRHQGXEGC-FYJGNVAPSA-N |
| XLogP | 3.42 |
| TPSA | 87.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|