C38H74O6Si3 — CID 25105533
(E,5S,7R,8R)-8-[tert-butyl(dimethyl)silyl]oxy-3-(phenylmethoxymethyl)-7-(2-trimethylsilylethoxymethoxy)-1-tri(propan-2-yl)silyloxynon-2-en-5-ol (PubChem CID 25105533) has the molecular formula C38H74O6Si3 and a molecular weight of 711.26 g/mol. Its IUPAC name is (E,5S,7R,8R)-8-[tert-butyl(dimethyl)silyl]oxy-3-(phenylmethoxymethyl)-7-(2-trimethylsilylethoxymethoxy)-1-tri(propan-2-yl)silyloxynon-2-en-5-ol.
| Compound Name | (E,5S,7R,8R)-8-[tert-butyl(dimethyl)silyl]oxy-3-(phenylmethoxymethyl)-7-(2-trimethylsilylethoxymethoxy)-1-tri(propan-2-yl)silyloxynon-2-en-5-ol |
|---|---|
| PubChem CID | 25105533 |
| Molecular Formula | C38H74O6Si3 |
| Molecular Weight | 711.26 g/mol |
| Exact Mass | 710.48 |
| IUPAC Name | (E,5S,7R,8R)-8-[tert-butyl(dimethyl)silyl]oxy-3-(phenylmethoxymethyl)-7-(2-trimethylsilylethoxymethoxy)-1-tri(propan-2-yl)silyloxynon-2-en-5-ol |
| SMILES | CC(C)[Si](OC/C=C(/COCc1ccccc1)C[C@H](O)C[C@@H](OCOCC[Si](C)(C)C)[C@@H](C)O[Si](C)(C)C(C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C38H74O6Si3/c1-30(2)47(31(3)4,32(5)6)43-22-21-35(28-41-27-34-19-17-16-18-20-34)25-36(39)26-37(42-29-40-23-24-45(11,12)13)33(7)44-46(14,15)38(8,9)10/h16-21,30-33,36-37,39H,22-29H2,1-15H3/b35-21+/t33-,36+,37-/m1/s1 |
| InChIKey | OWWOMDGVDNFWIO-QTBJRLOBSA-N |
| XLogP | 10.57 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.26 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|