C12H15N5O5 — CID 25105571
(3R,3aR,5R,6R,6aR)-5-(6-aminopurin-9-yl)-6a-(hydroxymethyl)-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan-3,6-diol (PubChem CID 25105571) has the molecular formula C12H15N5O5 and a molecular weight of 309.28 g/mol. Its IUPAC name is (3R,3aR,5R,6R,6aR)-5-(6-aminopurin-9-yl)-6a-(hydroxymethyl)-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan-3,6-diol.
| Compound Name | (3R,3aR,5R,6R,6aR)-5-(6-aminopurin-9-yl)-6a-(hydroxymethyl)-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan-3,6-diol |
|---|---|
| PubChem CID | 25105571 |
| Molecular Formula | C12H15N5O5 |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | (3R,3aR,5R,6R,6aR)-5-(6-aminopurin-9-yl)-6a-(hydroxymethyl)-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan-3,6-diol |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@@H]2[C@H](O)CO[C@]2(CO)[C@H]1O |
| InChI | InChI=1S/C12H15N5O5/c13-9-6-10(15-3-14-9)17(4-16-6)11-7(20)12(2-18)8(22-11)5(19)1-21-12/h3-5,7-8,11,18-20H,1-2H2,(H2,13,14,15)/t5-,7+,8-,11-,12-/m1/s1 |
| InChIKey | LFFAJVVSSMGTTC-QAQDZTRVSA-N |
| XLogP | -2.21 |
| TPSA | 148.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |