C19H17ClN4 — CID 25105630
4-[(E)-[(E)-(2-chloroquinolin-3-yl)methylidenehydrazinylidene]methyl]-N,N-dimethylaniline (PubChem CID 25105630) has the molecular formula C19H17ClN4 and a molecular weight of 336.83 g/mol. Its IUPAC name is 4-[(E)-[(E)-(2-chloroquinolin-3-yl)methylidenehydrazinylidene]methyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-[(E)-(2-chloroquinolin-3-yl)methylidenehydrazinylidene]methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 25105630 |
| Molecular Formula | C19H17ClN4 |
| Molecular Weight | 336.83 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 4-[(E)-[(E)-(2-chloroquinolin-3-yl)methylidenehydrazinylidene]methyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C=N/N=C/c2cc3ccccc3nc2Cl)cc1 |
| InChI | InChI=1S/C19H17ClN4/c1-24(2)17-9-7-14(8-10-17)12-21-22-13-16-11-15-5-3-4-6-18(15)23-19(16)20/h3-13H,1-2H3/b21-12+,22-13+ |
| InChIKey | NKYDJVYDWMUZNK-ADYPVIEZSA-N |
| XLogP | 4.41 |
| TPSA | 40.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.83 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|