C16H20N2O2 — CID 25109597
6-[(1R,4S)-4-aminocycloheptyl]oxy-2H-isoquinolin-1-one (PubChem CID 25109597) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 6-[(1R,4S)-4-aminocycloheptyl]oxy-2H-isoquinolin-1-one.
| Compound Name | 6-[(1R,4S)-4-aminocycloheptyl]oxy-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 25109597 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 6-[(1R,4S)-4-aminocycloheptyl]oxy-2H-isoquinolin-1-one |
| SMILES | N[C@H]1CCC[C@@H](Oc2ccc3c(=O)[nH]ccc3c2)CC1 |
| InChI | InChI=1S/C16H20N2O2/c17-12-2-1-3-13(5-4-12)20-14-6-7-15-11(10-14)8-9-18-16(15)19/h6-10,12-13H,1-5,17H2,(H,18,19)/t12-,13+/m0/s1 |
| InChIKey | VHUZNTCMWXTFOL-QWHCGFSZSA-N |
| XLogP | 2.57 |
| TPSA | 68.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |