About 6-(4-aminocyclohexyl)oxy-7-chloro-2H-isoquinolin-1-one;fluorobenzene
6-(4-aminocyclohexyl)oxy-7-chloro-2H-isoquinolin-1-one;fluorobenzene (PubChem CID 143705642) has the molecular formula C21H22ClFN2O2
and a molecular weight of 388.87 g/mol. Its IUPAC name is 6-(4-aminocyclohexyl)oxy-7-chloro-2H-isoquinolin-1-one;fluorobenzene.
Molecular Properties
| Compound Name | 6-(4-aminocyclohexyl)oxy-7-chloro-2H-isoquinolin-1-one;fluorobenzene |
| PubChem CID | 143705642 |
| Molecular Formula | C21H22ClFN2O2 |
| Molecular Weight | 388.87 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 6-(4-aminocyclohexyl)oxy-7-chloro-2H-isoquinolin-1-one;fluorobenzene |
| SMILES | Fc1ccccc1.NC1CCC(Oc2cc3cc[nH]c(=O)c3cc2Cl)CC1 |
| InChI | InChI=1S/C15H17ClN2O2.C6H5F/c16-13-8-12-9(5-6-18-15(12)19)7-14(13)20-11-3-1-10(17)2-4-11;7-6-4-2-1-3-5-6/h5-8,10-11H,1-4,17H2,(H,18,19);1-5H |
| InChIKey | JNIWEJLZMFRZJP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 68.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.87 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(4-aminocyclohexyl)oxy-7-chloro-2H-isoquinolin-1-one;fluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-aminocyclohexyl)oxy-7-chloro-2H-isoquinolin-1-one;fluorobenzene?
The IUPAC name of 6-(4-aminocyclohexyl)oxy-7-chloro-2H-isoquinolin-1-one;fluorobenzene (CID 143705642) is 6-(4-aminocyclohexyl)oxy-7-chloro-2H-isoquinolin-1-one;fluorobenzene.
What is the SMILES notation for 6-(4-aminocyclohexyl)oxy-7-chloro-2H-isoquinolin-1-one;fluorobenzene?
The canonical SMILES for 6-(4-aminocyclohexyl)oxy-7-chloro-2H-isoquinolin-1-one;fluorobenzene is Fc1ccccc1.NC1CCC(Oc2cc3cc[nH]c(=O)c3cc2Cl)CC1.
What is the InChIKey of 6-(4-aminocyclohexyl)oxy-7-chloro-2H-isoquinolin-1-one;fluorobenzene?
The InChIKey is JNIWEJLZMFRZJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17ClN2O2.C6H5F/c16-13-8-12-9(5-6-18-15(12)19)7-14(13)20-11-3-1-10(17)2-4-11;7-6-4-2-1-3-5-6/h5-8,10-11H,1-4,17H2,(H,18,19);1-5H.
What are the key properties of 6-(4-aminocyclohexyl)oxy-7-chloro-2H-isoquinolin-1-one;fluorobenzene?
6-(4-aminocyclohexyl)oxy-7-chloro-2H-isoquinolin-1-one;fluorobenzene has a molecular weight of 388.87 g/mol, XLogP of 4.66, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-aminocyclohexyl)oxy-7-chloro-2H-isoquinolin-1-one;fluorobenzene is sourced from PubChem (CID 143705642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).