C21H27ClN2O2 — CID 68630944
6-(3-amino-4-cyclohexylcyclohexyl)oxy-7-chloro-2H-isoquinolin-1-one (PubChem CID 68630944) has the molecular formula C21H27ClN2O2 and a molecular weight of 374.91 g/mol. Its IUPAC name is 6-(3-amino-4-cyclohexylcyclohexyl)oxy-7-chloro-2H-isoquinolin-1-one.
| Compound Name | 6-(3-amino-4-cyclohexylcyclohexyl)oxy-7-chloro-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 68630944 |
| Molecular Formula | C21H27ClN2O2 |
| Molecular Weight | 374.91 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 6-(3-amino-4-cyclohexylcyclohexyl)oxy-7-chloro-2H-isoquinolin-1-one |
| SMILES | NC1CC(Oc2cc3cc[nH]c(=O)c3cc2Cl)CCC1C1CCCCC1 |
| InChI | InChI=1S/C21H27ClN2O2/c22-18-12-17-14(8-9-24-21(17)25)10-20(18)26-15-6-7-16(19(23)11-15)13-4-2-1-3-5-13/h8-10,12-13,15-16,19H,1-7,11,23H2,(H,24,25) |
| InChIKey | WIKVGEHXUBZFOO-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 68.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.91 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |