About 6-[4-(1-aminopropyl)cyclohexyl]oxy-7-chloro-2H-isoquinolin-1-one;anisole
6-[4-(1-aminopropyl)cyclohexyl]oxy-7-chloro-2H-isoquinolin-1-one;anisole (PubChem CID 143916927) has the molecular formula C25H31ClN2O3
and a molecular weight of 442.99 g/mol. Its IUPAC name is 6-[4-(1-aminopropyl)cyclohexyl]oxy-7-chloro-2H-isoquinolin-1-one;anisole.
Molecular Properties
| Compound Name | 6-[4-(1-aminopropyl)cyclohexyl]oxy-7-chloro-2H-isoquinolin-1-one;anisole |
| PubChem CID | 143916927 |
| Molecular Formula | C25H31ClN2O3 |
| Molecular Weight | 442.99 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 6-[4-(1-aminopropyl)cyclohexyl]oxy-7-chloro-2H-isoquinolin-1-one;anisole |
| SMILES | CCC(N)C1CCC(Oc2cc3cc[nH]c(=O)c3cc2Cl)CC1.COc1ccccc1 |
| InChI | InChI=1S/C18H23ClN2O2.C7H8O/c1-2-16(20)11-3-5-13(6-4-11)23-17-9-12-7-8-21-18(22)14(12)10-15(17)19;1-8-7-5-3-2-4-6-7/h7-11,13,16H,2-6,20H2,1H3,(H,21,22);2-6H,1H3 |
| InChIKey | INPUZIIAFPQURI-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 77.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.99 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[4-(1-aminopropyl)cyclohexyl]oxy-7-chloro-2H-isoquinolin-1-one;anisole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-(1-aminopropyl)cyclohexyl]oxy-7-chloro-2H-isoquinolin-1-one;anisole?
The IUPAC name of 6-[4-(1-aminopropyl)cyclohexyl]oxy-7-chloro-2H-isoquinolin-1-one;anisole (CID 143916927) is 6-[4-(1-aminopropyl)cyclohexyl]oxy-7-chloro-2H-isoquinolin-1-one;anisole.
What is the SMILES notation for 6-[4-(1-aminopropyl)cyclohexyl]oxy-7-chloro-2H-isoquinolin-1-one;anisole?
The canonical SMILES for 6-[4-(1-aminopropyl)cyclohexyl]oxy-7-chloro-2H-isoquinolin-1-one;anisole is CCC(N)C1CCC(Oc2cc3cc[nH]c(=O)c3cc2Cl)CC1.COc1ccccc1.
What is the InChIKey of 6-[4-(1-aminopropyl)cyclohexyl]oxy-7-chloro-2H-isoquinolin-1-one;anisole?
The InChIKey is INPUZIIAFPQURI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23ClN2O2.C7H8O/c1-2-16(20)11-3-5-13(6-4-11)23-17-9-12-7-8-21-18(22)14(12)10-15(17)19;1-8-7-5-3-2-4-6-7/h7-11,13,16H,2-6,20H2,1H3,(H,21,22);2-6H,1H3.
What are the key properties of 6-[4-(1-aminopropyl)cyclohexyl]oxy-7-chloro-2H-isoquinolin-1-one;anisole?
6-[4-(1-aminopropyl)cyclohexyl]oxy-7-chloro-2H-isoquinolin-1-one;anisole has a molecular weight of 442.99 g/mol, XLogP of 5.55, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-(1-aminopropyl)cyclohexyl]oxy-7-chloro-2H-isoquinolin-1-one;anisole is sourced from PubChem (CID 143916927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).