C25H31ClN2O3 — CID 143916927
6-[4-(1-aminopropyl)cyclohexyl]oxy-7-chloro-2H-isoquinolin-1-one;anisole (PubChem CID 143916927) has the molecular formula C25H31ClN2O3 and a molecular weight of 442.99 g/mol. Its IUPAC name is 6-[4-(1-aminopropyl)cyclohexyl]oxy-7-chloro-2H-isoquinolin-1-one;anisole.
| Compound Name | 6-[4-(1-aminopropyl)cyclohexyl]oxy-7-chloro-2H-isoquinolin-1-one;anisole |
|---|---|
| PubChem CID | 143916927 |
| Molecular Formula | C25H31ClN2O3 |
| Molecular Weight | 442.99 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 6-[4-(1-aminopropyl)cyclohexyl]oxy-7-chloro-2H-isoquinolin-1-one;anisole |
| SMILES | CCC(N)C1CCC(Oc2cc3cc[nH]c(=O)c3cc2Cl)CC1.COc1ccccc1 |
| InChI | InChI=1S/C18H23ClN2O2.C7H8O/c1-2-16(20)11-3-5-13(6-4-11)23-17-9-12-7-8-21-18(22)14(12)10-15(17)19;1-8-7-5-3-2-4-6-7/h7-11,13,16H,2-6,20H2,1H3,(H,21,22);2-6H,1H3 |
| InChIKey | INPUZIIAFPQURI-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 77.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.99 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |