C24H26ClFN2O2 — CID 58380989
6-[4-(2-aminopropyl)-4-(4-fluorophenyl)cyclohexyl]oxy-7-chloro-2H-isoquinolin-1-one (PubChem CID 58380989) has the molecular formula C24H26ClFN2O2 and a molecular weight of 428.94 g/mol. Its IUPAC name is 6-[4-(2-aminopropyl)-4-(4-fluorophenyl)cyclohexyl]oxy-7-chloro-2H-isoquinolin-1-one.
| Compound Name | 6-[4-(2-aminopropyl)-4-(4-fluorophenyl)cyclohexyl]oxy-7-chloro-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 58380989 |
| Molecular Formula | C24H26ClFN2O2 |
| Molecular Weight | 428.94 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 6-[4-(2-aminopropyl)-4-(4-fluorophenyl)cyclohexyl]oxy-7-chloro-2H-isoquinolin-1-one |
| SMILES | CC(N)CC1(c2ccc(F)cc2)CCC(Oc2cc3cc[nH]c(=O)c3cc2Cl)CC1 |
| InChI | InChI=1S/C24H26ClFN2O2/c1-15(27)14-24(17-2-4-18(26)5-3-17)9-6-19(7-10-24)30-22-12-16-8-11-28-23(29)20(16)13-21(22)25/h2-5,8,11-13,15,19H,6-7,9-10,14,27H2,1H3,(H,28,29) |
| InChIKey | SLOMWEIGJRPZDA-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 68.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.94 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |