C28H26ClFN2O2 — CID 142761831
6-[4-[(4-aminophenyl)methyl]-4-(4-fluorophenyl)cyclohexyl]oxy-7-chloro-2H-isoquinolin-1-one (PubChem CID 142761831) has the molecular formula C28H26ClFN2O2 and a molecular weight of 476.98 g/mol. Its IUPAC name is 6-[4-[(4-aminophenyl)methyl]-4-(4-fluorophenyl)cyclohexyl]oxy-7-chloro-2H-isoquinolin-1-one.
| Compound Name | 6-[4-[(4-aminophenyl)methyl]-4-(4-fluorophenyl)cyclohexyl]oxy-7-chloro-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 142761831 |
| Molecular Formula | C28H26ClFN2O2 |
| Molecular Weight | 476.98 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | 6-[4-[(4-aminophenyl)methyl]-4-(4-fluorophenyl)cyclohexyl]oxy-7-chloro-2H-isoquinolin-1-one |
| SMILES | Nc1ccc(CC2(c3ccc(F)cc3)CCC(Oc3cc4cc[nH]c(=O)c4cc3Cl)CC2)cc1 |
| InChI | InChI=1S/C28H26ClFN2O2/c29-25-16-24-19(11-14-32-27(24)33)15-26(25)34-23-9-12-28(13-10-23,20-3-5-21(30)6-4-20)17-18-1-7-22(31)8-2-18/h1-8,11,14-16,23H,9-10,12-13,17,31H2,(H,32,33) |
| InChIKey | VBQZUJSRZZWUDZ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 68.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.98 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|