C24H35ClN2O2 — CID 67329784
6-[4-(3-amino-5-methylhexan-3-yl)-4-ethylcyclohexyl]oxy-7-chloro-2H-isoquinolin-1-one (PubChem CID 67329784) has the molecular formula C24H35ClN2O2 and a molecular weight of 419.01 g/mol. Its IUPAC name is 6-[4-(3-amino-5-methylhexan-3-yl)-4-ethylcyclohexyl]oxy-7-chloro-2H-isoquinolin-1-one.
| Compound Name | 6-[4-(3-amino-5-methylhexan-3-yl)-4-ethylcyclohexyl]oxy-7-chloro-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 67329784 |
| Molecular Formula | C24H35ClN2O2 |
| Molecular Weight | 419.01 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | 6-[4-(3-amino-5-methylhexan-3-yl)-4-ethylcyclohexyl]oxy-7-chloro-2H-isoquinolin-1-one |
| SMILES | CCC(N)(CC(C)C)C1(CC)CCC(Oc2cc3cc[nH]c(=O)c3cc2Cl)CC1 |
| InChI | InChI=1S/C24H35ClN2O2/c1-5-23(24(26,6-2)15-16(3)4)10-7-18(8-11-23)29-21-13-17-9-12-27-22(28)19(17)14-20(21)25/h9,12-14,16,18H,5-8,10-11,15,26H2,1-4H3,(H,27,28) |
| InChIKey | REZQBQUGAWXSKM-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 68.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.01 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |