C29H34ClNO2 — CID 58380937
7-chloro-6-[4-(1-cyclopropylpentan-3-yl)-4-phenylcyclohexyl]oxy-2H-isoquinolin-1-one (PubChem CID 58380937) has the molecular formula C29H34ClNO2 and a molecular weight of 464.05 g/mol. Its IUPAC name is 7-chloro-6-[4-(1-cyclopropylpentan-3-yl)-4-phenylcyclohexyl]oxy-2H-isoquinolin-1-one.
| Compound Name | 7-chloro-6-[4-(1-cyclopropylpentan-3-yl)-4-phenylcyclohexyl]oxy-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 58380937 |
| Molecular Formula | C29H34ClNO2 |
| Molecular Weight | 464.05 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | 7-chloro-6-[4-(1-cyclopropylpentan-3-yl)-4-phenylcyclohexyl]oxy-2H-isoquinolin-1-one |
| SMILES | CCC(CCC1CC1)C1(c2ccccc2)CCC(Oc2cc3cc[nH]c(=O)c3cc2Cl)CC1 |
| InChI | InChI=1S/C29H34ClNO2/c1-2-22(11-10-20-8-9-20)29(23-6-4-3-5-7-23)15-12-24(13-16-29)33-27-18-21-14-17-31-28(32)25(21)19-26(27)30/h3-7,14,17-20,22,24H,2,8-13,15-16H2,1H3,(H,31,32) |
| InChIKey | HVDGNZKLVWLRCI-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.05 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |