C20H25NO4S — CID 25112201
methyl (3aS,4S,8aS)-4-methyl-8-methylidene-2-(4-methylphenyl)sulfonyl-1,3,3a,4,7,8a-hexahydrocyclohepta[c]pyrrole-5-carboxylate (PubChem CID 25112201) has the molecular formula C20H25NO4S and a molecular weight of 375.49 g/mol. Its IUPAC name is methyl (3aS,4S,8aS)-4-methyl-8-methylidene-2-(4-methylphenyl)sulfonyl-1,3,3a,4,7,8a-hexahydrocyclohepta[c]pyrrole-5-carboxylate.
| Compound Name | methyl (3aS,4S,8aS)-4-methyl-8-methylidene-2-(4-methylphenyl)sulfonyl-1,3,3a,4,7,8a-hexahydrocyclohepta[c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 25112201 |
| Molecular Formula | C20H25NO4S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | methyl (3aS,4S,8aS)-4-methyl-8-methylidene-2-(4-methylphenyl)sulfonyl-1,3,3a,4,7,8a-hexahydrocyclohepta[c]pyrrole-5-carboxylate |
| SMILES | C=C1CC=C(C(=O)OC)[C@@H](C)[C@@H]2CN(S(=O)(=O)c3ccc(C)cc3)C[C@H]12 |
| InChI | InChI=1S/C20H25NO4S/c1-13-5-8-16(9-6-13)26(23,24)21-11-18-14(2)7-10-17(20(22)25-4)15(3)19(18)12-21/h5-6,8-10,15,18-19H,2,7,11-12H2,1,3-4H3/t15-,18-,19+/m1/s1 |
| InChIKey | HEKPKQTVTZGZMU-LZQZEXGQSA-N |
| XLogP | 2.93 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|