About ethyl 3-(2,2-dichloroethenyl)-2-methyl-2-(2-phenylethyl)cyclopropane-1-carboxylate
ethyl 3-(2,2-dichloroethenyl)-2-methyl-2-(2-phenylethyl)cyclopropane-1-carboxylate (PubChem CID 25112883) has the molecular formula C17H20Cl2O2
and a molecular weight of 327.25 g/mol. Its IUPAC name is ethyl 3-(2,2-dichloroethenyl)-2-methyl-2-(2-phenylethyl)cyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-(2,2-dichloroethenyl)-2-methyl-2-(2-phenylethyl)cyclopropane-1-carboxylate |
| PubChem CID | 25112883 |
| Molecular Formula | C17H20Cl2O2 |
| Molecular Weight | 327.25 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | ethyl 3-(2,2-dichloroethenyl)-2-methyl-2-(2-phenylethyl)cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1C(C=C(Cl)Cl)C1(C)CCc1ccccc1 |
| InChI | InChI=1S/C17H20Cl2O2/c1-3-21-16(20)15-13(11-14(18)19)17(15,2)10-9-12-7-5-4-6-8-12/h4-8,11,13,15H,3,9-10H2,1-2H3 |
| InChIKey | FZCKHFJJDYRLFT-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.25 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethyl 3-(2,2-dichloroethenyl)-2-methyl-2-(2-phenylethyl)cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(2,2-dichloroethenyl)-2-methyl-2-(2-phenylethyl)cyclopropane-1-carboxylate?
The IUPAC name of ethyl 3-(2,2-dichloroethenyl)-2-methyl-2-(2-phenylethyl)cyclopropane-1-carboxylate (CID 25112883) is ethyl 3-(2,2-dichloroethenyl)-2-methyl-2-(2-phenylethyl)cyclopropane-1-carboxylate.
What is the SMILES notation for ethyl 3-(2,2-dichloroethenyl)-2-methyl-2-(2-phenylethyl)cyclopropane-1-carboxylate?
The canonical SMILES for ethyl 3-(2,2-dichloroethenyl)-2-methyl-2-(2-phenylethyl)cyclopropane-1-carboxylate is CCOC(=O)C1C(C=C(Cl)Cl)C1(C)CCc1ccccc1.
What is the InChIKey of ethyl 3-(2,2-dichloroethenyl)-2-methyl-2-(2-phenylethyl)cyclopropane-1-carboxylate?
The InChIKey is FZCKHFJJDYRLFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20Cl2O2/c1-3-21-16(20)15-13(11-14(18)19)17(15,2)10-9-12-7-5-4-6-8-12/h4-8,11,13,15H,3,9-10H2,1-2H3.
What are the key properties of ethyl 3-(2,2-dichloroethenyl)-2-methyl-2-(2-phenylethyl)cyclopropane-1-carboxylate?
ethyl 3-(2,2-dichloroethenyl)-2-methyl-2-(2-phenylethyl)cyclopropane-1-carboxylate has a molecular weight of 327.25 g/mol, XLogP of 4.75, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(2,2-dichloroethenyl)-2-methyl-2-(2-phenylethyl)cyclopropane-1-carboxylate is sourced from PubChem (CID 25112883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).