C20H20F3NO4S — CID 2511323
[2-(trifluoromethyl)phenyl]methyl 3-piperidin-1-ylsulfonylbenzoate (PubChem CID 2511323) has the molecular formula C20H20F3NO4S and a molecular weight of 427.44 g/mol. Its IUPAC name is [2-(trifluoromethyl)phenyl]methyl 3-piperidin-1-ylsulfonylbenzoate.
| Compound Name | [2-(trifluoromethyl)phenyl]methyl 3-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2511323 |
| Molecular Formula | C20H20F3NO4S |
| Molecular Weight | 427.44 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | [2-(trifluoromethyl)phenyl]methyl 3-piperidin-1-ylsulfonylbenzoate |
| SMILES | O=C(OCc1ccccc1C(F)(F)F)c1cccc(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C20H20F3NO4S/c21-20(22,23)18-10-3-2-7-16(18)14-28-19(25)15-8-6-9-17(13-15)29(26,27)24-11-4-1-5-12-24/h2-3,6-10,13H,1,4-5,11-12,14H2 |
| InChIKey | ZMWQQPGXYKTARW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.44 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |