C21H17FN4O2 — CID 25115179
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(6-fluoro-2-pyridinyl)-6-methylimidazo[1,2-a]pyridin-3-amine (PubChem CID 25115179) has the molecular formula C21H17FN4O2 and a molecular weight of 376.39 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(6-fluoro-2-pyridinyl)-6-methylimidazo[1,2-a]pyridin-3-amine.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(6-fluoro-2-pyridinyl)-6-methylimidazo[1,2-a]pyridin-3-amine |
|---|---|
| PubChem CID | 25115179 |
| Molecular Formula | C21H17FN4O2 |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(6-fluoro-2-pyridinyl)-6-methylimidazo[1,2-a]pyridin-3-amine |
| SMILES | Cc1ccc2nc(-c3cccc(F)n3)c(Nc3ccc4c(c3)OCCO4)n2c1 |
| InChI | InChI=1S/C21H17FN4O2/c1-13-5-8-19-25-20(15-3-2-4-18(22)24-15)21(26(19)12-13)23-14-6-7-16-17(11-14)28-10-9-27-16/h2-8,11-12,23H,9-10H2,1H3 |
| InChIKey | LTKHVKUJQJROTL-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_65_Db(5)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|