C21H14ClF2N3O2 — CID 58402642
2-(2-chloro-6-fluorophenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-fluoroimidazo[1,2-a]pyridin-3-amine (PubChem CID 58402642) has the molecular formula C21H14ClF2N3O2 and a molecular weight of 413.81 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-fluoroimidazo[1,2-a]pyridin-3-amine.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-fluoroimidazo[1,2-a]pyridin-3-amine |
|---|---|
| PubChem CID | 58402642 |
| Molecular Formula | C21H14ClF2N3O2 |
| Molecular Weight | 413.81 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-fluoroimidazo[1,2-a]pyridin-3-amine |
| SMILES | Fc1cccc(Cl)c1-c1nc2cccc(F)n2c1Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C21H14ClF2N3O2/c22-13-3-1-4-14(23)19(13)20-21(27-17(24)5-2-6-18(27)26-20)25-12-7-8-15-16(11-12)29-10-9-28-15/h1-8,11,25H,9-10H2 |
| InChIKey | ARGKERNQRKLDIH-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 47.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.81 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|