C19H29NO10 — CID 25117512
3-(4-methyl-2,5-dioxofuran-3-yl)-N-[5-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentyl]propanamide (PubChem CID 25117512) has the molecular formula C19H29NO10 and a molecular weight of 431.44 g/mol. Its IUPAC name is 3-(4-methyl-2,5-dioxofuran-3-yl)-N-[5-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentyl]propanamide.
| Compound Name | 3-(4-methyl-2,5-dioxofuran-3-yl)-N-[5-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentyl]propanamide |
|---|---|
| PubChem CID | 25117512 |
| Molecular Formula | C19H29NO10 |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 3-(4-methyl-2,5-dioxofuran-3-yl)-N-[5-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentyl]propanamide |
| SMILES | CC1=C(CCC(=O)NCCCCCO[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)C(=O)OC1=O |
| InChI | InChI=1S/C19H29NO10/c1-10-11(18(27)30-17(10)26)5-6-13(22)20-7-3-2-4-8-28-19-16(25)15(24)14(23)12(9-21)29-19/h12,14-16,19,21,23-25H,2-9H2,1H3,(H,20,22)/t12-,14+,15+,16-,19-/m1/s1 |
| InChIKey | JNBIFNQCIFLZNZ-SNOASFMESA-N |
| XLogP | -1.73 |
| TPSA | 171.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|