C22H28N6O2S — CID 25118853
N-[2-[[6-[[2-[cyclohexyl(methyl)amino]-1,3-benzothiazol-6-yl]oxy]pyrimidin-4-yl]amino]ethyl]acetamide (PubChem CID 25118853) has the molecular formula C22H28N6O2S and a molecular weight of 440.57 g/mol. Its IUPAC name is N-[2-[[6-[[2-[cyclohexyl(methyl)amino]-1,3-benzothiazol-6-yl]oxy]pyrimidin-4-yl]amino]ethyl]acetamide.
| Compound Name | N-[2-[[6-[[2-[cyclohexyl(methyl)amino]-1,3-benzothiazol-6-yl]oxy]pyrimidin-4-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 25118853 |
| Molecular Formula | C22H28N6O2S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | N-[2-[[6-[[2-[cyclohexyl(methyl)amino]-1,3-benzothiazol-6-yl]oxy]pyrimidin-4-yl]amino]ethyl]acetamide |
| SMILES | CC(=O)NCCNc1cc(Oc2ccc3nc(N(C)C4CCCCC4)sc3c2)ncn1 |
| InChI | InChI=1S/C22H28N6O2S/c1-15(29)23-10-11-24-20-13-21(26-14-25-20)30-17-8-9-18-19(12-17)31-22(27-18)28(2)16-6-4-3-5-7-16/h8-9,12-14,16H,3-7,10-11H2,1-2H3,(H,23,29)(H,24,25,26) |
| InChIKey | PCIMPIZUMJQYBB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|