C28H31F3N4O3 — CID 25119023
N-[3-[3-(2-amino-2-iminoethoxy)phenyl]-4-phenylbutan-2-yl]-2-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propanamide (PubChem CID 25119023) has the molecular formula C28H31F3N4O3 and a molecular weight of 528.58 g/mol. Its IUPAC name is N-[3-[3-(2-amino-2-iminoethoxy)phenyl]-4-phenylbutan-2-yl]-2-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propanamide.
| Compound Name | N-[3-[3-(2-amino-2-iminoethoxy)phenyl]-4-phenylbutan-2-yl]-2-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propanamide |
|---|---|
| PubChem CID | 25119023 |
| Molecular Formula | C28H31F3N4O3 |
| Molecular Weight | 528.58 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | N-[3-[3-(2-amino-2-iminoethoxy)phenyl]-4-phenylbutan-2-yl]-2-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propanamide |
| SMILES | [H]/N=C(\N)COc1cccc(C(Cc2ccccc2)C(C)NC(=O)C(C)(C)Oc2ccc(C(F)(F)F)cn2)c1 |
| InChI | InChI=1S/C28H31F3N4O3/c1-18(35-26(36)27(2,3)38-25-13-12-21(16-34-25)28(29,30)31)23(14-19-8-5-4-6-9-19)20-10-7-11-22(15-20)37-17-24(32)33/h4-13,15-16,18,23H,14,17H2,1-3H3,(H3,32,33)(H,35,36) |
| InChIKey | BMULGWNZQRFPIK-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 110.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.58 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|