C27H30F3N5O2 — CID 25119030
N-[3-(3-carbamimidoylphenyl)-4-(5-methyl-2-pyridinyl)butan-2-yl]-2-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propanamide (PubChem CID 25119030) has the molecular formula C27H30F3N5O2 and a molecular weight of 513.56 g/mol. Its IUPAC name is N-[3-(3-carbamimidoylphenyl)-4-(5-methyl-2-pyridinyl)butan-2-yl]-2-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propanamide.
| Compound Name | N-[3-(3-carbamimidoylphenyl)-4-(5-methyl-2-pyridinyl)butan-2-yl]-2-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propanamide |
|---|---|
| PubChem CID | 25119030 |
| Molecular Formula | C27H30F3N5O2 |
| Molecular Weight | 513.56 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | N-[3-(3-carbamimidoylphenyl)-4-(5-methyl-2-pyridinyl)butan-2-yl]-2-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propanamide |
| SMILES | [H]/N=C(\N)c1cccc(C(Cc2ccc(C)cn2)C(C)NC(=O)C(C)(C)Oc2ccc(C(F)(F)F)cn2)c1 |
| InChI | InChI=1S/C27H30F3N5O2/c1-16-8-10-21(33-14-16)13-22(18-6-5-7-19(12-18)24(31)32)17(2)35-25(36)26(3,4)37-23-11-9-20(15-34-23)27(28,29)30/h5-12,14-15,17,22H,13H2,1-4H3,(H3,31,32)(H,35,36) |
| InChIKey | LMYHVJPESYKGHK-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 113.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.56 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|