C29H33F3N4O3 — CID 25119026
N-[3-[3-(2-amino-2-iminoethoxy)phenyl]-4-(4-methylphenyl)butan-2-yl]-2-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propanamide (PubChem CID 25119026) has the molecular formula C29H33F3N4O3 and a molecular weight of 542.60 g/mol. Its IUPAC name is N-[3-[3-(2-amino-2-iminoethoxy)phenyl]-4-(4-methylphenyl)butan-2-yl]-2-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propanamide.
| Compound Name | N-[3-[3-(2-amino-2-iminoethoxy)phenyl]-4-(4-methylphenyl)butan-2-yl]-2-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propanamide |
|---|---|
| PubChem CID | 25119026 |
| Molecular Formula | C29H33F3N4O3 |
| Molecular Weight | 542.60 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | N-[3-[3-(2-amino-2-iminoethoxy)phenyl]-4-(4-methylphenyl)butan-2-yl]-2-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propanamide |
| SMILES | [H]/N=C(\N)COc1cccc(C(Cc2ccc(C)cc2)C(C)NC(=O)C(C)(C)Oc2ccc(C(F)(F)F)cn2)c1 |
| InChI | InChI=1S/C29H33F3N4O3/c1-18-8-10-20(11-9-18)14-24(21-6-5-7-23(15-21)38-17-25(33)34)19(2)36-27(37)28(3,4)39-26-13-12-22(16-35-26)29(30,31)32/h5-13,15-16,19,24H,14,17H2,1-4H3,(H3,33,34)(H,36,37) |
| InChIKey | JVJFVXTXVFRXMR-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 110.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.60 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|