C40H62ClN3O5S2 — CID 25119739
7-[(1R)-2-[2-[3-[2-(2-chlorophenyl)ethylamino]propylsulfanyl]ethylamino]-1-hydroxyethyl]-4-hydroxy-3H-1,3-benzothiazol-2-one;(Z)-octadec-9-enoic acid (PubChem CID 25119739) has the molecular formula C40H62ClN3O5S2 and a molecular weight of 764.54 g/mol. Its IUPAC name is 7-[(1R)-2-[2-[3-[2-(2-chlorophenyl)ethylamino]propylsulfanyl]ethylamino]-1-hydroxyethyl]-4-hydroxy-3H-1,3-benzothiazol-2-one;(Z)-octadec-9-enoic acid.
| Compound Name | 7-[(1R)-2-[2-[3-[2-(2-chlorophenyl)ethylamino]propylsulfanyl]ethylamino]-1-hydroxyethyl]-4-hydroxy-3H-1,3-benzothiazol-2-one;(Z)-octadec-9-enoic acid |
|---|---|
| PubChem CID | 25119739 |
| Molecular Formula | C40H62ClN3O5S2 |
| Molecular Weight | 764.54 g/mol |
| Exact Mass | 763.38 |
| IUPAC Name | 7-[(1R)-2-[2-[3-[2-(2-chlorophenyl)ethylamino]propylsulfanyl]ethylamino]-1-hydroxyethyl]-4-hydroxy-3H-1,3-benzothiazol-2-one;(Z)-octadec-9-enoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)O.O=c1[nH]c2c(O)ccc([C@@H](O)CNCCSCCCNCCc3ccccc3Cl)c2s1 |
| InChI | InChI=1S/C22H28ClN3O3S2.C18H34O2/c23-17-5-2-1-4-15(17)8-10-24-9-3-12-30-13-11-25-14-19(28)16-6-7-18(27)20-21(16)31-22(29)26-20;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h1-2,4-7,19,24-25,27-28H,3,8-14H2,(H,26,29);9-10H,2-8,11-17H2,1H3,(H,19,20)/b;10-9-/t19-;/m0./s1 |
| InChIKey | RATKMAHVHVHZNZ-ZBDQOYRZSA-N |
| XLogP | 9.64 |
| TPSA | 134.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.54 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|