C25H33NO5 — CID 25123612
methyl 3-[4-[3-(4-acetamidophenyl)propyl]-3-(2-methoxyethoxy)phenyl]-2-methylpropanoate (PubChem CID 25123612) has the molecular formula C25H33NO5 and a molecular weight of 427.54 g/mol. Its IUPAC name is methyl 3-[4-[3-(4-acetamidophenyl)propyl]-3-(2-methoxyethoxy)phenyl]-2-methylpropanoate.
| Compound Name | methyl 3-[4-[3-(4-acetamidophenyl)propyl]-3-(2-methoxyethoxy)phenyl]-2-methylpropanoate |
|---|---|
| PubChem CID | 25123612 |
| Molecular Formula | C25H33NO5 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | methyl 3-[4-[3-(4-acetamidophenyl)propyl]-3-(2-methoxyethoxy)phenyl]-2-methylpropanoate |
| SMILES | COCCOc1cc(CC(C)C(=O)OC)ccc1CCCc1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C25H33NO5/c1-18(25(28)30-4)16-21-8-11-22(24(17-21)31-15-14-29-3)7-5-6-20-9-12-23(13-10-20)26-19(2)27/h8-13,17-18H,5-7,14-16H2,1-4H3,(H,26,27) |
| InChIKey | KDYAOIHQVNRLCL-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|