C25H28N2O3S — CID 25126550
3-[3-[(4-methyl-1-benzothiophen-3-yl)methyl]-2-oxobenzimidazol-1-yl]octanoic acid (PubChem CID 25126550) has the molecular formula C25H28N2O3S and a molecular weight of 436.58 g/mol. Its IUPAC name is 3-[3-[(4-methyl-1-benzothiophen-3-yl)methyl]-2-oxobenzimidazol-1-yl]octanoic acid.
| Compound Name | 3-[3-[(4-methyl-1-benzothiophen-3-yl)methyl]-2-oxobenzimidazol-1-yl]octanoic acid |
|---|---|
| PubChem CID | 25126550 |
| Molecular Formula | C25H28N2O3S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 3-[3-[(4-methyl-1-benzothiophen-3-yl)methyl]-2-oxobenzimidazol-1-yl]octanoic acid |
| SMILES | CCCCCC(CC(=O)O)n1c(=O)n(Cc2csc3cccc(C)c23)c2ccccc21 |
| InChI | InChI=1S/C25H28N2O3S/c1-3-4-5-10-19(14-23(28)29)27-21-12-7-6-11-20(21)26(25(27)30)15-18-16-31-22-13-8-9-17(2)24(18)22/h6-9,11-13,16,19H,3-5,10,14-15H2,1-2H3,(H,28,29) |
| InChIKey | POEWVCKDHYRIJQ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 64.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|