C24H28N2O3S2 — CID 68683957
4-[1-[(4-methyl-1-benzothiophen-3-yl)methyl]benzimidazol-2-yl]sulfanylbutanoic acid;propan-2-ol (PubChem CID 68683957) has the molecular formula C24H28N2O3S2 and a molecular weight of 456.63 g/mol. Its IUPAC name is 4-[1-[(4-methyl-1-benzothiophen-3-yl)methyl]benzimidazol-2-yl]sulfanylbutanoic acid;propan-2-ol.
| Compound Name | 4-[1-[(4-methyl-1-benzothiophen-3-yl)methyl]benzimidazol-2-yl]sulfanylbutanoic acid;propan-2-ol |
|---|---|
| PubChem CID | 68683957 |
| Molecular Formula | C24H28N2O3S2 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 4-[1-[(4-methyl-1-benzothiophen-3-yl)methyl]benzimidazol-2-yl]sulfanylbutanoic acid;propan-2-ol |
| SMILES | CC(C)O.Cc1cccc2scc(Cn3c(SCCCC(=O)O)nc4ccccc43)c12 |
| InChI | InChI=1S/C21H20N2O2S2.C3H8O/c1-14-6-4-9-18-20(14)15(13-27-18)12-23-17-8-3-2-7-16(17)22-21(23)26-11-5-10-19(24)25;1-3(2)4/h2-4,6-9,13H,5,10-12H2,1H3,(H,24,25);3-4H,1-2H3 |
| InChIKey | FGDNOOAJTTWUGY-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|