C22H23N3O2S — CID 58803156
4-[1-[(3,7-dimethyl-3H-isoindol-1-yl)methyl]benzimidazol-2-yl]sulfanylbutanoic acid (PubChem CID 58803156) has the molecular formula C22H23N3O2S and a molecular weight of 393.51 g/mol. Its IUPAC name is 4-[1-[(3,7-dimethyl-3H-isoindol-1-yl)methyl]benzimidazol-2-yl]sulfanylbutanoic acid.
| Compound Name | 4-[1-[(3,7-dimethyl-3H-isoindol-1-yl)methyl]benzimidazol-2-yl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 58803156 |
| Molecular Formula | C22H23N3O2S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 4-[1-[(3,7-dimethyl-3H-isoindol-1-yl)methyl]benzimidazol-2-yl]sulfanylbutanoic acid |
| SMILES | Cc1cccc2c1C(Cn1c(SCCCC(=O)O)nc3ccccc31)=NC2C |
| InChI | InChI=1S/C22H23N3O2S/c1-14-7-5-8-16-15(2)23-18(21(14)16)13-25-19-10-4-3-9-17(19)24-22(25)28-12-6-11-20(26)27/h3-5,7-10,15H,6,11-13H2,1-2H3,(H,26,27) |
| InChIKey | CLQFSEJLQYOPTO-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|