C25H31N3O — CID 123225968
1-[(1,4-dimethylindol-3-yl)methyl]-3-heptan-4-ylbenzimidazol-2-one (PubChem CID 123225968) has the molecular formula C25H31N3O and a molecular weight of 389.54 g/mol. Its IUPAC name is 1-[(1,4-dimethylindol-3-yl)methyl]-3-heptan-4-ylbenzimidazol-2-one.
| Compound Name | 1-[(1,4-dimethylindol-3-yl)methyl]-3-heptan-4-ylbenzimidazol-2-one |
|---|---|
| PubChem CID | 123225968 |
| Molecular Formula | C25H31N3O |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.25 |
| IUPAC Name | 1-[(1,4-dimethylindol-3-yl)methyl]-3-heptan-4-ylbenzimidazol-2-one |
| SMILES | CCCC(CCC)n1c(=O)n(Cc2cn(C)c3cccc(C)c23)c2ccccc21 |
| InChI | InChI=1S/C25H31N3O/c1-5-10-20(11-6-2)28-22-14-8-7-13-21(22)27(25(28)29)17-19-16-26(4)23-15-9-12-18(3)24(19)23/h7-9,12-16,20H,5-6,10-11,17H2,1-4H3 |
| InChIKey | IMEOMBIBNPTWKM-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 31.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |