C28H23N3O5 — CID 69097990
(3S)-3-[1-[(1,4-dimethylindol-3-yl)methyl]-2,4-dioxoquinazolin-3-yl]-2-oxo-3-phenylpropanoic acid (PubChem CID 69097990) has the molecular formula C28H23N3O5 and a molecular weight of 481.51 g/mol. Its IUPAC name is (3S)-3-[1-[(1,4-dimethylindol-3-yl)methyl]-2,4-dioxoquinazolin-3-yl]-2-oxo-3-phenylpropanoic acid.
| Compound Name | (3S)-3-[1-[(1,4-dimethylindol-3-yl)methyl]-2,4-dioxoquinazolin-3-yl]-2-oxo-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 69097990 |
| Molecular Formula | C28H23N3O5 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | (3S)-3-[1-[(1,4-dimethylindol-3-yl)methyl]-2,4-dioxoquinazolin-3-yl]-2-oxo-3-phenylpropanoic acid |
| SMILES | Cc1cccc2c1c(Cn1c(=O)n([C@H](C(=O)C(=O)O)c3ccccc3)c(=O)c3ccccc31)cn2C |
| InChI | InChI=1S/C28H23N3O5/c1-17-9-8-14-22-23(17)19(15-29(22)2)16-30-21-13-7-6-12-20(21)26(33)31(28(30)36)24(25(32)27(34)35)18-10-4-3-5-11-18/h3-15,24H,16H2,1-2H3,(H,34,35)/t24-/m0/s1 |
| InChIKey | SNDBZOCYDYLTLI-DEOSSOPVSA-N |
| XLogP | 3.25 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|