About carbonic acid;1-cyclohexyl-3-[(1,4-dimethylindol-3-yl)methyl]benzimidazol-2-one
carbonic acid;1-cyclohexyl-3-[(1,4-dimethylindol-3-yl)methyl]benzimidazol-2-one (PubChem CID 67360244) has the molecular formula C25H29N3O4
and a molecular weight of 435.52 g/mol. Its IUPAC name is carbonic acid;1-cyclohexyl-3-[(1,4-dimethylindol-3-yl)methyl]benzimidazol-2-one.
Molecular Properties
| Compound Name | carbonic acid;1-cyclohexyl-3-[(1,4-dimethylindol-3-yl)methyl]benzimidazol-2-one |
| PubChem CID | 67360244 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | carbonic acid;1-cyclohexyl-3-[(1,4-dimethylindol-3-yl)methyl]benzimidazol-2-one |
| SMILES | Cc1cccc2c1c(Cn1c(=O)n(C3CCCCC3)c3ccccc31)cn2C.O=C(O)O |
| InChI | InChI=1S/C24H27N3O.CH2O3/c1-17-9-8-14-22-23(17)18(15-25(22)2)16-26-20-12-6-7-13-21(20)27(24(26)28)19-10-4-3-5-11-19;2-1(3)4/h6-9,12-15,19H,3-5,10-11,16H2,1-2H3;(H2,2,3,4) |
| InChIKey | JOFQOGVGUCFVCK-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze carbonic acid;1-cyclohexyl-3-[(1,4-dimethylindol-3-yl)methyl]benzimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonic acid;1-cyclohexyl-3-[(1,4-dimethylindol-3-yl)methyl]benzimidazol-2-one?
The IUPAC name of carbonic acid;1-cyclohexyl-3-[(1,4-dimethylindol-3-yl)methyl]benzimidazol-2-one (CID 67360244) is carbonic acid;1-cyclohexyl-3-[(1,4-dimethylindol-3-yl)methyl]benzimidazol-2-one.
What is the SMILES notation for carbonic acid;1-cyclohexyl-3-[(1,4-dimethylindol-3-yl)methyl]benzimidazol-2-one?
The canonical SMILES for carbonic acid;1-cyclohexyl-3-[(1,4-dimethylindol-3-yl)methyl]benzimidazol-2-one is Cc1cccc2c1c(Cn1c(=O)n(C3CCCCC3)c3ccccc31)cn2C.O=C(O)O.
What is the InChIKey of carbonic acid;1-cyclohexyl-3-[(1,4-dimethylindol-3-yl)methyl]benzimidazol-2-one?
The InChIKey is JOFQOGVGUCFVCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27N3O.CH2O3/c1-17-9-8-14-22-23(17)18(15-25(22)2)16-26-20-12-6-7-13-21(20)27(24(26)28)19-10-4-3-5-11-19;2-1(3)4/h6-9,12-15,19H,3-5,10-11,16H2,1-2H3;(H2,2,3,4).
What are the key properties of carbonic acid;1-cyclohexyl-3-[(1,4-dimethylindol-3-yl)methyl]benzimidazol-2-one?
carbonic acid;1-cyclohexyl-3-[(1,4-dimethylindol-3-yl)methyl]benzimidazol-2-one has a molecular weight of 435.52 g/mol, XLogP of 5.38, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;1-cyclohexyl-3-[(1,4-dimethylindol-3-yl)methyl]benzimidazol-2-one is sourced from PubChem (CID 67360244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).