About dilithium;[(E)-1,3-diphenylpropan-2-ylideneamino]-phenylazanide
dilithium;[(E)-1,3-diphenylpropan-2-ylideneamino]-phenylazanide (PubChem CID 25129895) has the molecular formula C21H18Li2N2
and a molecular weight of 312.27 g/mol. Its IUPAC name is dilithium;[(E)-1,3-diphenylpropan-2-ylideneamino]-phenylazanide.
Molecular Properties
| Compound Name | dilithium;[(E)-1,3-diphenylpropan-2-ylideneamino]-phenylazanide |
| PubChem CID | 25129895 |
| Molecular Formula | C21H18Li2N2 |
| Molecular Weight | 312.27 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | dilithium;[(E)-1,3-diphenylpropan-2-ylideneamino]-phenylazanide |
| SMILES | [Li+].[Li+].c1ccc([CH-]/C(Cc2ccccc2)=N\[N-]c2ccccc2)cc1 |
| InChI | InChI=1S/C21H18N2.2Li/c1-4-10-18(11-5-1)16-21(17-19-12-6-2-7-13-19)23-22-20-14-8-3-9-15-20;;/h1-16H,17H2;;/q-2;2*+1/b23-21+;; |
| InChIKey | XDASXZKQLWGQMX-GUSGXMBRSA-N |
| XLogP | -0.45 |
| TPSA | 26.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.27 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze dilithium;[(E)-1,3-diphenylpropan-2-ylideneamino]-phenylazanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dilithium;[(E)-1,3-diphenylpropan-2-ylideneamino]-phenylazanide?
The IUPAC name of dilithium;[(E)-1,3-diphenylpropan-2-ylideneamino]-phenylazanide (CID 25129895) is dilithium;[(E)-1,3-diphenylpropan-2-ylideneamino]-phenylazanide.
What is the SMILES notation for dilithium;[(E)-1,3-diphenylpropan-2-ylideneamino]-phenylazanide?
The canonical SMILES for dilithium;[(E)-1,3-diphenylpropan-2-ylideneamino]-phenylazanide is [Li+].[Li+].c1ccc([CH-]/C(Cc2ccccc2)=N\[N-]c2ccccc2)cc1.
What is the InChIKey of dilithium;[(E)-1,3-diphenylpropan-2-ylideneamino]-phenylazanide?
The InChIKey is XDASXZKQLWGQMX-GUSGXMBRSA-N. The full InChI is InChI=1S/C21H18N2.2Li/c1-4-10-18(11-5-1)16-21(17-19-12-6-2-7-13-19)23-22-20-14-8-3-9-15-20;;/h1-16H,17H2;;/q-2;2*+1/b23-21+;;.
What are the key properties of dilithium;[(E)-1,3-diphenylpropan-2-ylideneamino]-phenylazanide?
dilithium;[(E)-1,3-diphenylpropan-2-ylideneamino]-phenylazanide has a molecular weight of 312.27 g/mol, XLogP of -0.45, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dilithium;[(E)-1,3-diphenylpropan-2-ylideneamino]-phenylazanide is sourced from PubChem (CID 25129895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).