C25H26N4O2 — CID 25129937
[(2'E)-2'-hydroxyiminospiro[3,5-dihydro-2H-1-benzazepine-4,1'-cyclopentane]-1-yl]-[4-(3-methylpyrazol-1-yl)phenyl]methanone (PubChem CID 25129937) has the molecular formula C25H26N4O2 and a molecular weight of 414.51 g/mol. Its IUPAC name is [(2'E)-2'-hydroxyiminospiro[3,5-dihydro-2H-1-benzazepine-4,1'-cyclopentane]-1-yl]-[4-(3-methylpyrazol-1-yl)phenyl]methanone.
| Compound Name | [(2'E)-2'-hydroxyiminospiro[3,5-dihydro-2H-1-benzazepine-4,1'-cyclopentane]-1-yl]-[4-(3-methylpyrazol-1-yl)phenyl]methanone |
|---|---|
| PubChem CID | 25129937 |
| Molecular Formula | C25H26N4O2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | [(2'E)-2'-hydroxyiminospiro[3,5-dihydro-2H-1-benzazepine-4,1'-cyclopentane]-1-yl]-[4-(3-methylpyrazol-1-yl)phenyl]methanone |
| SMILES | Cc1ccn(-c2ccc(C(=O)N3CCC4(CCC/C4=N\O)Cc4ccccc43)cc2)n1 |
| InChI | InChI=1S/C25H26N4O2/c1-18-12-15-29(26-18)21-10-8-19(9-11-21)24(30)28-16-14-25(13-4-7-23(25)27-31)17-20-5-2-3-6-22(20)28/h2-3,5-6,8-12,15,31H,4,7,13-14,16-17H2,1H3/b27-23+ |
| InChIKey | PUVYODFPUPRYSN-SLEBQGDGSA-N |
| XLogP | 4.77 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|