C29H28FN3O3 — CID 25129938
5-fluoro-N-[4-[(2'E)-2'-hydroxyiminospiro[3,5-dihydro-2H-1-benzazepine-4,1'-cyclopentane]-1-carbonyl]phenyl]-2-methylbenzamide (PubChem CID 25129938) has the molecular formula C29H28FN3O3 and a molecular weight of 485.56 g/mol. Its IUPAC name is 5-fluoro-N-[4-[(2'E)-2'-hydroxyiminospiro[3,5-dihydro-2H-1-benzazepine-4,1'-cyclopentane]-1-carbonyl]phenyl]-2-methylbenzamide.
| Compound Name | 5-fluoro-N-[4-[(2'E)-2'-hydroxyiminospiro[3,5-dihydro-2H-1-benzazepine-4,1'-cyclopentane]-1-carbonyl]phenyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 25129938 |
| Molecular Formula | C29H28FN3O3 |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | 5-fluoro-N-[4-[(2'E)-2'-hydroxyiminospiro[3,5-dihydro-2H-1-benzazepine-4,1'-cyclopentane]-1-carbonyl]phenyl]-2-methylbenzamide |
| SMILES | Cc1ccc(F)cc1C(=O)Nc1ccc(C(=O)N2CCC3(CCC/C3=N\O)Cc3ccccc32)cc1 |
| InChI | InChI=1S/C29H28FN3O3/c1-19-8-11-22(30)17-24(19)27(34)31-23-12-9-20(10-13-23)28(35)33-16-15-29(14-4-7-26(29)32-36)18-21-5-2-3-6-25(21)33/h2-3,5-6,8-13,17,36H,4,7,14-16,18H2,1H3,(H,31,34)/b32-26+ |
| InChIKey | WKEXGYXQBTXXDL-HMZBKAONSA-N |
| XLogP | 5.98 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|