C25H27N3O2 — CID 25130997
1-[3-methyl-4-(3-methylphenyl)piperazin-1-yl]-2-(2-methyl-5-phenyl-1H-pyrrol-3-yl)ethane-1,2-dione (PubChem CID 25130997) has the molecular formula C25H27N3O2 and a molecular weight of 401.51 g/mol. Its IUPAC name is 1-[3-methyl-4-(3-methylphenyl)piperazin-1-yl]-2-(2-methyl-5-phenyl-1H-pyrrol-3-yl)ethane-1,2-dione.
| Compound Name | 1-[3-methyl-4-(3-methylphenyl)piperazin-1-yl]-2-(2-methyl-5-phenyl-1H-pyrrol-3-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 25130997 |
| Molecular Formula | C25H27N3O2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | 1-[3-methyl-4-(3-methylphenyl)piperazin-1-yl]-2-(2-methyl-5-phenyl-1H-pyrrol-3-yl)ethane-1,2-dione |
| SMILES | Cc1cccc(N2CCN(C(=O)C(=O)c3cc(-c4ccccc4)[nH]c3C)CC2C)c1 |
| InChI | InChI=1S/C25H27N3O2/c1-17-8-7-11-21(14-17)28-13-12-27(16-18(28)2)25(30)24(29)22-15-23(26-19(22)3)20-9-5-4-6-10-20/h4-11,14-15,18,26H,12-13,16H2,1-3H3 |
| InChIKey | DBDSEWXCSGWBDU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|