C12H11N3O3S — CID 25131488
N-[4-(2-methyl-1,3-thiazol-4-yl)-2-nitrophenyl]acetamide (PubChem CID 25131488) has the molecular formula C12H11N3O3S and a molecular weight of 277.31 g/mol. Its IUPAC name is N-[4-(2-methyl-1,3-thiazol-4-yl)-2-nitrophenyl]acetamide.
| Compound Name | N-[4-(2-methyl-1,3-thiazol-4-yl)-2-nitrophenyl]acetamide |
|---|---|
| PubChem CID | 25131488 |
| Molecular Formula | C12H11N3O3S |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | N-[4-(2-methyl-1,3-thiazol-4-yl)-2-nitrophenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(-c2csc(C)n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H11N3O3S/c1-7(16)13-10-4-3-9(5-12(10)15(17)18)11-6-19-8(2)14-11/h3-6H,1-2H3,(H,13,16) |
| InChIKey | HCROBKFJATXYCU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|