C17H13N3O3S2 — CID 2574351
N-(3-nitrophenyl)-2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetamide (PubChem CID 2574351) has the molecular formula C17H13N3O3S2 and a molecular weight of 371.44 g/mol. Its IUPAC name is N-(3-nitrophenyl)-2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-(3-nitrophenyl)-2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 2574351 |
| Molecular Formula | C17H13N3O3S2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | N-(3-nitrophenyl)-2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1nc(-c2ccccc2)cs1)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H13N3O3S2/c21-16(18-13-7-4-8-14(9-13)20(22)23)11-25-17-19-15(10-24-17)12-5-2-1-3-6-12/h1-10H,11H2,(H,18,21) |
| InChIKey | DRNQKLUHLUYHPV-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|