C25H23FN2O3 — CID 25132703
1-[4-(4-fluorobenzoyl)piperidin-1-yl]-2-(2-methyl-5-phenyl-1H-pyrrol-3-yl)ethane-1,2-dione (PubChem CID 25132703) has the molecular formula C25H23FN2O3 and a molecular weight of 418.47 g/mol. Its IUPAC name is 1-[4-(4-fluorobenzoyl)piperidin-1-yl]-2-(2-methyl-5-phenyl-1H-pyrrol-3-yl)ethane-1,2-dione.
| Compound Name | 1-[4-(4-fluorobenzoyl)piperidin-1-yl]-2-(2-methyl-5-phenyl-1H-pyrrol-3-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 25132703 |
| Molecular Formula | C25H23FN2O3 |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 1-[4-(4-fluorobenzoyl)piperidin-1-yl]-2-(2-methyl-5-phenyl-1H-pyrrol-3-yl)ethane-1,2-dione |
| SMILES | Cc1[nH]c(-c2ccccc2)cc1C(=O)C(=O)N1CCC(C(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C25H23FN2O3/c1-16-21(15-22(27-16)17-5-3-2-4-6-17)24(30)25(31)28-13-11-19(12-14-28)23(29)18-7-9-20(26)10-8-18/h2-10,15,19,27H,11-14H2,1H3 |
| InChIKey | XOELRIZFIHHDOL-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|