C20H23N3O3 — CID 41310074
1-(4-benzoylpiperidin-1-yl)-2-(1,3,5-trimethylpyrazol-4-yl)ethane-1,2-dione (PubChem CID 41310074) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is 1-(4-benzoylpiperidin-1-yl)-2-(1,3,5-trimethylpyrazol-4-yl)ethane-1,2-dione.
| Compound Name | 1-(4-benzoylpiperidin-1-yl)-2-(1,3,5-trimethylpyrazol-4-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 41310074 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 1-(4-benzoylpiperidin-1-yl)-2-(1,3,5-trimethylpyrazol-4-yl)ethane-1,2-dione |
| SMILES | Cc1nn(C)c(C)c1C(=O)C(=O)N1CCC(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C20H23N3O3/c1-13-17(14(2)22(3)21-13)19(25)20(26)23-11-9-16(10-12-23)18(24)15-7-5-4-6-8-15/h4-8,16H,9-12H2,1-3H3 |
| InChIKey | BIRWVIJINXYPLX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|