About 1-amino-3-pentylthiourea
1-amino-3-pentylthiourea (PubChem CID 2513311) has the molecular formula C6H15N3S
and a molecular weight of 161.27 g/mol. Its IUPAC name is 1-amino-3-pentylthiourea.
Molecular Properties
| Compound Name | 1-amino-3-pentylthiourea |
| PubChem CID | 2513311 |
| Molecular Formula | C6H15N3S |
| Molecular Weight | 161.27 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 1-amino-3-pentylthiourea |
| SMILES | CCCCCNC(=S)NN |
| InChI | InChI=1S/C6H15N3S/c1-2-3-4-5-8-6(10)9-7/h2-5,7H2,1H3,(H2,8,9,10) |
| InChIKey | XNTMPLHUDNWDCQ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.27 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-3-pentylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-pentylthiourea?
The IUPAC name of 1-amino-3-pentylthiourea (CID 2513311) is 1-amino-3-pentylthiourea.
What is the SMILES notation for 1-amino-3-pentylthiourea?
The canonical SMILES for 1-amino-3-pentylthiourea is CCCCCNC(=S)NN.
What is the InChIKey of 1-amino-3-pentylthiourea?
The InChIKey is XNTMPLHUDNWDCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N3S/c1-2-3-4-5-8-6(10)9-7/h2-5,7H2,1H3,(H2,8,9,10).
What are the key properties of 1-amino-3-pentylthiourea?
1-amino-3-pentylthiourea has a molecular weight of 161.27 g/mol, XLogP of 0.51, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-pentylthiourea is sourced from PubChem (CID 2513311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).