C37H46FN5O9S — CID 25134701
naphthalen-1-ylmethyl (1S,4S,7E,14S)-4-(cyclopropylsulfonylcarbamoyl)-14-(3-fluoropropoxycarbonylamino)-2,15-dioxo-3,16,19-triazatricyclo[14.4.0.04,6]icos-7-ene-19-carboxylate (PubChem CID 25134701) has the molecular formula C37H46FN5O9S and a molecular weight of 755.87 g/mol. Its IUPAC name is naphthalen-1-ylmethyl (1S,4S,7E,14S)-4-(cyclopropylsulfonylcarbamoyl)-14-(3-fluoropropoxycarbonylamino)-2,15-dioxo-3,16,19-triazatricyclo[14.4.0.04,6]icos-7-ene-19-carboxylate.
| Compound Name | naphthalen-1-ylmethyl (1S,4S,7E,14S)-4-(cyclopropylsulfonylcarbamoyl)-14-(3-fluoropropoxycarbonylamino)-2,15-dioxo-3,16,19-triazatricyclo[14.4.0.04,6]icos-7-ene-19-carboxylate |
|---|---|
| PubChem CID | 25134701 |
| Molecular Formula | C37H46FN5O9S |
| Molecular Weight | 755.87 g/mol |
| Exact Mass | 755.30 |
| IUPAC Name | naphthalen-1-ylmethyl (1S,4S,7E,14S)-4-(cyclopropylsulfonylcarbamoyl)-14-(3-fluoropropoxycarbonylamino)-2,15-dioxo-3,16,19-triazatricyclo[14.4.0.04,6]icos-7-ene-19-carboxylate |
| SMILES | O=C(N[C@H]1CCCCC/C=C/C2C[C@]2(C(=O)NS(=O)(=O)C2CC2)NC(=O)[C@@H]2CN(C(=O)OCc3cccc4ccccc34)CCN2C1=O)OCCCF |
| InChI | InChI=1S/C37H46FN5O9S/c38-18-9-21-51-35(47)39-30-15-5-3-1-2-4-13-27-22-37(27,34(46)41-53(49,50)28-16-17-28)40-32(44)31-23-42(19-20-43(31)33(30)45)36(48)52-24-26-12-8-11-25-10-6-7-14-29(25)26/h4,6-8,10-14,27-28,30-31H,1-3,5,9,15-24H2,(H,39,47)(H,40,44)(H,41,46)/b13-4+/t27?,30-,31-,37-/m0/s1 |
| InChIKey | GVDNLGDONLWJRQ-ZQNSLTHHSA-N |
| XLogP | 3.45 |
| TPSA | 180.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.87 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|