C23H33NO5SSi2 — CID 25137136
tert-butyl 7-[1,5-bis(trimethylsilyl)penta-1,4-diyn-3-ylidene]-3-methyl-5,5,8-trioxo-5λ6-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 25137136) has the molecular formula C23H33NO5SSi2 and a molecular weight of 491.76 g/mol. Its IUPAC name is tert-butyl 7-[1,5-bis(trimethylsilyl)penta-1,4-diyn-3-ylidene]-3-methyl-5,5,8-trioxo-5λ6-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | tert-butyl 7-[1,5-bis(trimethylsilyl)penta-1,4-diyn-3-ylidene]-3-methyl-5,5,8-trioxo-5λ6-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 25137136 |
| Molecular Formula | C23H33NO5SSi2 |
| Molecular Weight | 491.76 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | tert-butyl 7-[1,5-bis(trimethylsilyl)penta-1,4-diyn-3-ylidene]-3-methyl-5,5,8-trioxo-5λ6-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC1=C(C(=O)OC(C)(C)C)N2C(=O)C(=C(C#C[Si](C)(C)C)C#C[Si](C)(C)C)C2S(=O)(=O)C1 |
| InChI | InChI=1S/C23H33NO5SSi2/c1-16-15-30(27,28)21-18(17(11-13-31(5,6)7)12-14-32(8,9)10)20(25)24(21)19(16)22(26)29-23(2,3)4/h21H,15H2,1-10H3 |
| InChIKey | ZKACKMUBKAQQAV-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.76 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|