C15H25NO3Si — CID 59650712
tert-butyl (2S)-2-(3-trimethylsilylprop-2-ynoyl)pyrrolidine-1-carboxylate (PubChem CID 59650712) has the molecular formula C15H25NO3Si and a molecular weight of 295.45 g/mol. Its IUPAC name is tert-butyl (2S)-2-(3-trimethylsilylprop-2-ynoyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-(3-trimethylsilylprop-2-ynoyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 59650712 |
| Molecular Formula | C15H25NO3Si |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | tert-butyl (2S)-2-(3-trimethylsilylprop-2-ynoyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C15H25NO3Si/c1-15(2,3)19-14(18)16-10-7-8-12(16)13(17)9-11-20(4,5)6/h12H,7-8,10H2,1-6H3/t12-/m0/s1 |
| InChIKey | YBWXRZBMAVUXAE-LBPRGKRZSA-N |
| XLogP | 2.84 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|