C19H20N6O3S — CID 25138027
3-[[4-[5-(methanesulfonamido)-2-methylanilino]pyrimidin-2-yl]amino]benzamide (PubChem CID 25138027) has the molecular formula C19H20N6O3S and a molecular weight of 412.48 g/mol. Its IUPAC name is 3-[[4-[5-(methanesulfonamido)-2-methylanilino]pyrimidin-2-yl]amino]benzamide.
| Compound Name | 3-[[4-[5-(methanesulfonamido)-2-methylanilino]pyrimidin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 25138027 |
| Molecular Formula | C19H20N6O3S |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 3-[[4-[5-(methanesulfonamido)-2-methylanilino]pyrimidin-2-yl]amino]benzamide |
| SMILES | Cc1ccc(NS(C)(=O)=O)cc1Nc1ccnc(Nc2cccc(C(N)=O)c2)n1 |
| InChI | InChI=1S/C19H20N6O3S/c1-12-6-7-15(25-29(2,27)28)11-16(12)23-17-8-9-21-19(24-17)22-14-5-3-4-13(10-14)18(20)26/h3-11,25H,1-2H3,(H2,20,26)(H2,21,22,23,24) |
| InChIKey | QTHIVEIOENULRA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 139.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |