C25H20F3N5O2 — CID 44532680
3-[[4-[4-(2-methylphenoxy)-3-(trifluoromethyl)anilino]pyrimidin-2-yl]amino]benzamide (PubChem CID 44532680) has the molecular formula C25H20F3N5O2 and a molecular weight of 479.46 g/mol. Its IUPAC name is 3-[[4-[4-(2-methylphenoxy)-3-(trifluoromethyl)anilino]pyrimidin-2-yl]amino]benzamide.
| Compound Name | 3-[[4-[4-(2-methylphenoxy)-3-(trifluoromethyl)anilino]pyrimidin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 44532680 |
| Molecular Formula | C25H20F3N5O2 |
| Molecular Weight | 479.46 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 3-[[4-[4-(2-methylphenoxy)-3-(trifluoromethyl)anilino]pyrimidin-2-yl]amino]benzamide |
| SMILES | Cc1ccccc1Oc1ccc(Nc2ccnc(Nc3cccc(C(N)=O)c3)n2)cc1C(F)(F)F |
| InChI | InChI=1S/C25H20F3N5O2/c1-15-5-2-3-8-20(15)35-21-10-9-18(14-19(21)25(26,27)28)31-22-11-12-30-24(33-22)32-17-7-4-6-16(13-17)23(29)34/h2-14H,1H3,(H2,29,34)(H2,30,31,32,33) |
| InChIKey | HUALFRVDYKJKSZ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.46 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |