C23H24N2O5S — CID 25138498
ethyl 2-[(3S,4S,5S)-5-(4-cyanophenyl)-4-formyl-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]acetate (PubChem CID 25138498) has the molecular formula C23H24N2O5S and a molecular weight of 440.52 g/mol. Its IUPAC name is ethyl 2-[(3S,4S,5S)-5-(4-cyanophenyl)-4-formyl-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]acetate.
| Compound Name | ethyl 2-[(3S,4S,5S)-5-(4-cyanophenyl)-4-formyl-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]acetate |
|---|---|
| PubChem CID | 25138498 |
| Molecular Formula | C23H24N2O5S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | ethyl 2-[(3S,4S,5S)-5-(4-cyanophenyl)-4-formyl-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1CN(S(=O)(=O)c2ccc(C)cc2)[C@H](c2ccc(C#N)cc2)[C@H]1C=O |
| InChI | InChI=1S/C23H24N2O5S/c1-3-30-22(27)12-19-14-25(31(28,29)20-10-4-16(2)5-11-20)23(21(19)15-26)18-8-6-17(13-24)7-9-18/h4-11,15,19,21,23H,3,12,14H2,1-2H3/t19-,21+,23-/m1/s1 |
| InChIKey | ROVJAFFYCMAPGU-UNWVZKJWSA-N |
| XLogP | 3.00 |
| TPSA | 104.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|