C14H23ClO2 — CID 25139111
5-(chloromethyl)-2-octyl-2,3-dihydropyran-6-one (PubChem CID 25139111) has the molecular formula C14H23ClO2 and a molecular weight of 258.79 g/mol. Its IUPAC name is 5-(chloromethyl)-2-octyl-2,3-dihydropyran-6-one.
| Compound Name | 5-(chloromethyl)-2-octyl-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 25139111 |
| Molecular Formula | C14H23ClO2 |
| Molecular Weight | 258.79 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 5-(chloromethyl)-2-octyl-2,3-dihydropyran-6-one |
| SMILES | CCCCCCCCC1CC=C(CCl)C(=O)O1 |
| InChI | InChI=1S/C14H23ClO2/c1-2-3-4-5-6-7-8-13-10-9-12(11-15)14(16)17-13/h9,13H,2-8,10-11H2,1H3 |
| InChIKey | FOJJODMXDFZTCG-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.79 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|