C15H22O3 — CID 46837950
ethyl (E)-2-methyl-3-[(2S,6S)-4-methylidene-6-prop-2-enyloxan-2-yl]prop-2-enoate (PubChem CID 46837950) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is ethyl (E)-2-methyl-3-[(2S,6S)-4-methylidene-6-prop-2-enyloxan-2-yl]prop-2-enoate.
| Compound Name | ethyl (E)-2-methyl-3-[(2S,6S)-4-methylidene-6-prop-2-enyloxan-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 46837950 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | ethyl (E)-2-methyl-3-[(2S,6S)-4-methylidene-6-prop-2-enyloxan-2-yl]prop-2-enoate |
| SMILES | C=CC[C@H]1CC(=C)C[C@@H](/C=C(\C)C(=O)OCC)O1 |
| InChI | InChI=1S/C15H22O3/c1-5-7-13-8-11(3)9-14(18-13)10-12(4)15(16)17-6-2/h5,10,13-14H,1,3,6-9H2,2,4H3/b12-10+/t13-,14-/m0/s1 |
| InChIKey | RXZGZAKLURCXAW-IRTDIPEASA-N |
| XLogP | 3.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|