C31H44BrNO4S2 — CID 25141087
tert-butyl (2R,3R,4S,5R)-2-(4-bromophenyl)-4-hexylsulfanyl-1-(4-methylphenyl)sulfonyl-5-propylpyrrolidine-3-carboxylate (PubChem CID 25141087) has the molecular formula C31H44BrNO4S2 and a molecular weight of 638.73 g/mol. Its IUPAC name is tert-butyl (2R,3R,4S,5R)-2-(4-bromophenyl)-4-hexylsulfanyl-1-(4-methylphenyl)sulfonyl-5-propylpyrrolidine-3-carboxylate.
| Compound Name | tert-butyl (2R,3R,4S,5R)-2-(4-bromophenyl)-4-hexylsulfanyl-1-(4-methylphenyl)sulfonyl-5-propylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 25141087 |
| Molecular Formula | C31H44BrNO4S2 |
| Molecular Weight | 638.73 g/mol |
| Exact Mass | 637.19 |
| IUPAC Name | tert-butyl (2R,3R,4S,5R)-2-(4-bromophenyl)-4-hexylsulfanyl-1-(4-methylphenyl)sulfonyl-5-propylpyrrolidine-3-carboxylate |
| SMILES | CCCCCCS[C@H]1[C@@H](C(=O)OC(C)(C)C)[C@H](c2ccc(Br)cc2)N(S(=O)(=O)c2ccc(C)cc2)[C@@H]1CCC |
| InChI | InChI=1S/C31H44BrNO4S2/c1-7-9-10-11-21-38-29-26(12-8-2)33(39(35,36)25-19-13-22(3)14-20-25)28(23-15-17-24(32)18-16-23)27(29)30(34)37-31(4,5)6/h13-20,26-29H,7-12,21H2,1-6H3/t26-,27+,28+,29-/m1/s1 |
| InChIKey | IZYUAJPEDNEPJE-GIFPIDKJSA-N |
| XLogP | 8.31 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.73 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|